693-55-0 Ethyl hydrogen sebacate
| ürün Ad? |
Ethyl hydrogen sebacate |
| ingilizce ad? |
Ethyl hydrogen sebacate; Monoethyl sebacate~Sebacic acid monoethyl ester; monoethyl sebacate; Decanedioic acid monoethyl ester~Monoethyl sebacate~Sebacic acid monoethyl ester; 10-ethoxy-10-oxodecanoic acid |
| Moleküler Formülü |
C12H22O4 |
| Molekül A??rl??? |
230.3007 |
| InChI |
InChI=1/C12H22O4/c1-2-16-12(15)10-8-6-4-3-5-7-9-11(13)14/h2-10H2,1H3,(H,13,14) |
| CAS kay?t numaras? |
693-55-0 |
| EINECS |
211-753-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.024g/cm3 |
| Kaynama noktas? |
336°C at 760 mmHg |
| K?r?lma indisi |
1.455 |
| Alevlenme noktas? |
119°C |
| Buhar bas?nc? |
2.17E-05mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|