625-33-2 3-penten-2-one
| ürün Ad? |
3-penten-2-one |
| ingilizce ad? |
3-penten-2-one; ethylideneacetone; pent-3-en-2-one; (3E)-pent-3-en-2-one; (3Z)-pent-3-en-2-one |
| Moleküler Formülü |
C5H8O |
| Molekül A??rl??? |
84.1164 |
| InChI |
InChI=1/C5H8O/c1-3-4-5(2)6/h3-4H,1-2H3/b4-3- |
| CAS kay?t numaras? |
625-33-2 |
| EINECS |
210-888-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.826g/cm3 |
| Kaynama noktas? |
122°C at 760 mmHg |
| K?r?lma indisi |
1.411 |
| Alevlenme noktas? |
19.8°C |
| Buhar bas?nc? |
14.2mmHg at 25°C |
| Risk Kodlar? |
R10:Flammable.;
R20/21:Harmful by inhalation and in contact with skin.;
R36/37:Irritating to eyes and respiratory system.;
|
| Güvenlik A??klamas? |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|