605-62-9 4-Nitro-1-Naphthol
| ürün Ad? |
4-Nitro-1-Naphthol |
| ingilizce ad? |
4-Nitro-1-Naphthol; 4-nitronaphthalen-1-ol |
| Moleküler Formülü |
C10H7NO3 |
| Molekül A??rl??? |
189.1675 |
| InChI |
InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
| CAS kay?t numaras? |
605-62-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.413g/cm3 |
| Kaynama noktas? |
398.8°C at 760 mmHg |
| K?r?lma indisi |
1.714 |
| Alevlenme noktas? |
179.8°C |
| Buhar bas?nc? |
6.25E-07mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|