604-59-1 Alpha-Naphthoflavone
| ürün Ad? |
Alpha-Naphthoflavone |
| ingilizce ad? |
Alpha-Naphthoflavone; 7,8-Benzoflavone; 2-phenylbenzo(h)chromen-4-one; 2-phenyl-4H-benzo[h]chromen-4-one |
| Moleküler Formülü |
C19H12O2 |
| Molekül A??rl??? |
272.2974 |
| InChI |
InChI=1/C19H12O2/c20-17-12-18(14-7-2-1-3-8-14)21-19-15-9-5-4-6-13(15)10-11-16(17)19/h1-12H |
| CAS kay?t numaras? |
604-59-1 |
| EINECS |
210-071-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.276g/cm3 |
| Ergime noktas? |
155-157℃ |
| Kaynama noktas? |
460.9°C at 760 mmHg |
| K?r?lma indisi |
1.695 |
| Alevlenme noktas? |
215.8°C |
| Buhar bas?nc? |
1.12E-08mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|