602-87-9 5-Nitroacenaphthene
| ürün Ad? |
5-Nitroacenaphthene |
| ingilizce ad? |
5-Nitroacenaphthene;1,2-Dihydro-5-nitro-acenaphthylene; 4-05-00-01840 (Beilstein Handbook Reference); 5-Nan; 5-Nitroacenaphthylene; 5-Nitroacenapthene; 5-Nitronaphthalene; 5-Nitronaphthalene ethylene; Acenaphthene, 5-nitro-; Acenaphthylene, 1,2-dihydro-5-nitro-; BRN 1876864; CCRIS 438; HSDB 4092; NCI-C01967; NSC 1312; NSC 22421; 1,2-Dihydro-5-nitroacenaphthylene; 5-nitro-1,2-dihydroacenaphthylene; Nitroacenaphthene; 1,2-dihydro-5-nitro-acenaphthylen |
| Moleküler Formülü |
C12H7NO2 |
| Molekül A??rl??? |
197.1895 |
| InChI |
InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
| CAS kay?t numaras? |
602-87-9 |
| EINECS |
210-025-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.408g/cm3 |
| Ergime noktas? |
101-102℃ |
| Kaynama noktas? |
381.6°C at 760 mmHg |
| K?r?lma indisi |
1.763 |
| Alevlenme noktas? |
196.7°C |
| Buhar bas?nc? |
1.1E-05mmHg at 25°C |
| Risk Kodlar? |
R45:May cause cancer.;
|
| Güvenlik A??klamas? |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|