588-43-2 tributyl orthoformate
| ürün Ad? |
tributyl orthoformate |
| ingilizce ad? |
tributyl orthoformate; 1-(Dibutoxymethoxy)butane; 1,1',1''-(Methylidynetris(oxy))tributane; Butane, 1,1',1''-(methylidynetris(oxy))tris-; butane, 1,1',1''-[methylidynetris(oxy)]tris-; Orthoformic acid, tributyl ester; Orthoformic acid, tributyl ester (8CI) |
| Moleküler Formülü |
C13H28O3 |
| Molekül A??rl??? |
232.3596 |
| InChI |
InChI=1/C13H28O3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h13H,4-12H2,1-3H3 |
| CAS kay?t numaras? |
588-43-2 |
| EINECS |
209-618-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.884g/cm3 |
| Kaynama noktas? |
262.7°C at 760 mmHg |
| K?r?lma indisi |
1.427 |
| Alevlenme noktas? |
96.3°C |
| Buhar bas?nc? |
0.0175mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|