5781-53-3 Methyl oxalyl chloride
| ürün Ad? |
Methyl oxalyl chloride |
| ingilizce ad? |
Methyl oxalyl chloride; Methyl chloroglyoxylate; Monomethyl oxalyl chloride; methyl chlorooxoacetate; Chloroglyoxylic acid methyl ester |
| Moleküler Formülü |
C3H3ClO3 |
| Molekül A??rl??? |
122.5071 |
| InChI |
InChI=1/C3H3ClO3/c1-7-3(6)2(4)5/h1H3 |
| CAS kay?t numaras? |
5781-53-3 |
| EINECS |
227-307-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.36g/cm3 |
| Kaynama noktas? |
119°C at 760 mmHg |
| K?r?lma indisi |
1.416 |
| Alevlenme noktas? |
46.7°C |
| Buhar bas?nc? |
16.3mmHg at 25°C |
| Tehlike Sembolleri |
C:Corrosive;
|
| Risk Kodlar? |
R10:Flammable.;
R34:Causes burns.;
|
| Güvenlik A??klamas? |
S16:Keep away from sources of ignition - No smoking.;
S28A:After contact with skin, wash immediately with plenty of water.;
S9:Keep container in a well-ventilated place.;
|
|