ChemNet > CAS > 5570-18-3 (2-Aminophenyl)boronic acid
5570-18-3 (2-Aminophenyl)boronic acid
| ürün Ad? |
(2-Aminophenyl)boronic acid |
| ingilizce ad? |
(2-Aminophenyl)boronic acid; 2-Aminophenylboronic acid; N'-[(1Z)-(2,5-dimethoxyphenyl)methylidene]-2-[(4-methylphenyl)amino]acetohydrazide (non-preferred name); 2-Aminophenylboronic Acid Hcl |
| Moleküler Formülü |
C18H21N3O3 |
| Molekül A??rl??? |
327.3776 |
| InChI |
InChI=1/C18H21N3O3/c1-13-4-6-15(7-5-13)19-12-18(22)21-20-11-14-10-16(23-2)8-9-17(14)24-3/h4-11,19H,12H2,1-3H3,(H,21,22)/b20-11- |
| CAS kay?t numaras? |
5570-18-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.14g/cm3 |
| K?r?lma indisi |
1.558 |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|