4964-71-0 5-Bromo-quinoline
| ürün Ad? |
5-Bromo-quinoline |
| ingilizce ad? |
5-Bromo-quinoline; 5-Bromoquinoline; RARECHEM AK ML 0010; 5-Bromoquinoline,97% |
| Moleküler Formülü |
C9H6BrN |
| Molekül A??rl??? |
208.0546 |
| InChI |
InChI=1/C9H6BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
| CAS kay?t numaras? |
4964-71-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.564g/cm3 |
| Kaynama noktas? |
295.9°C at 760 mmHg |
| K?r?lma indisi |
1.673 |
| Alevlenme noktas? |
132.8°C |
| Buhar bas?nc? |
0.00261mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|