4705-34-4 4,4'-Dimethoxystilbene
| ürün Ad? |
4,4'-Dimethoxystilbene |
| ingilizce ad? |
4,4'-Dimethoxystilbene; 1-methoxy-4-((E)-2-(4-methoxyphenyl)ethenyl)benzene
; 1,1'-ethene-1,2-diylbis(4-methoxybenzene); 1,1'-(E)-ethene-1,2-diylbis(4-methoxybenzene) |
| Moleküler Formülü |
C16H16O2 |
| Molekül A??rl??? |
240.297 |
| InChI |
InChI=1/C16H16O2/c1-17-15-9-5-13(6-10-15)3-4-14-7-11-16(18-2)12-8-14/h3-12H,1-2H3/b4-3+ |
| CAS kay?t numaras? |
4705-34-4 |
| EINECS |
225-189-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.089g/cm3 |
| Ergime noktas? |
213-215℃ |
| Kaynama noktas? |
391.3°C at 760 mmHg |
| K?r?lma indisi |
1.615 |
| Alevlenme noktas? |
159.3°C |
| Buhar bas?nc? |
5.61E-06mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|