447-31-4 Desyl chloride
| ürün Ad? |
Desyl chloride |
| ingilizce ad? |
Desyl chloride; alpha-Chloro-alpha-phenylacetophenone; alpha-chlorodeoxybenzoin; 2-chloro-1,2-diphenylethanone; (2R)-2-chloro-1,2-diphenylethanone; (2S)-2-chloro-1,2-diphenylethanone |
| Moleküler Formülü |
C14H11ClO |
| Molekül A??rl??? |
230.6895 |
| InChI |
InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
| CAS kay?t numaras? |
447-31-4 |
| EINECS |
207-181-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.19g/cm3 |
| Ergime noktas? |
65-69℃ |
| Kaynama noktas? |
345.5°C at 760 mmHg |
| K?r?lma indisi |
1.592 |
| Alevlenme noktas? |
190.4°C |
| Buhar bas?nc? |
6.14E-05mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R20/21:Harmful by inhalation and in contact with skin.;
R37:Irritating to respiratory system.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S24:Avoid contact with skin.;
|
|