ChemNet > CAS > 4122-68-3 4-Chlorophenoxyacetyl chloride
4122-68-3 4-Chlorophenoxyacetyl chloride
| ürün Ad? |
4-Chlorophenoxyacetyl chloride |
| ingilizce ad? |
4-Chlorophenoxyacetyl chloride; (4-Chlorophenoxy)acetyl chloride; p-chlorophenoxyacetyl chloride |
| Moleküler Formülü |
C8H6Cl2O2 |
| Molekül A??rl??? |
205.038 |
| InChI |
InChI=1/C8H6Cl2O2/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2 |
| CAS kay?t numaras? |
4122-68-3 |
| EINECS |
223-923-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.363g/cm3 |
| Ergime noktas? |
18.8℃ |
| Kaynama noktas? |
264.5°C at 760 mmHg |
| K?r?lma indisi |
1.542 |
| Alevlenme noktas? |
112.9°C |
| Buhar bas?nc? |
0.00965mmHg at 25°C |
| Tehlike Sembolleri |
C:Corrosive;
|
| Risk Kodlar? |
R34:Causes burns.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|