33733-73-2 3-Bromothioanisole
| ürün Ad? |
3-Bromothioanisole |
| ingilizce ad? |
3-Bromothioanisole; 3-Bromophenyl methyl sulphide; 3-Bromothioanisol/3-Bromophenyl methyl sulphide; 1-Bromo-3-(methylthio)benzene; m-Bromothioanisole; 1-bromo-3-(methylsulfanyl)benzene; 1-(bromosulfanyl)-3-methoxybenzene |
| Moleküler Formülü |
C7H7BrOS |
| Molekül A??rl??? |
219.0989 |
| InChI |
InChI=1/C7H7BrOS/c1-9-6-3-2-4-7(5-6)10-8/h2-5H,1H3 |
| CAS kay?t numaras? |
33733-73-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.567g/cm3 |
| Kaynama noktas? |
278.106°C at 760 mmHg |
| K?r?lma indisi |
1.616 |
| Alevlenme noktas? |
121.995°C |
| Buhar bas?nc? |
0.007mmHg at 25°C |
| Risk Kodlar? |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik A??klamas? |
S23:;
S24/25:;
|
|