ChemNet > CAS > 306-37-6 sym-Dimethylhydrazine dihydrochloride
306-37-6 sym-Dimethylhydrazine dihydrochloride
| ürün Ad? |
sym-Dimethylhydrazine dihydrochloride |
| ingilizce ad? |
sym-Dimethylhydrazine dihydrochloride; 1,2-Dimethylhydrazine dihydrochloride; 1,2-dimethylhydrazine; 1,1-dimethylhydrazine dihydrochloride |
| Moleküler Formülü |
C2H10Cl2N2 |
| Molekül A??rl??? |
133.0202 |
| InChI |
InChI=1/C2H8N2.2ClH/c1-4(2)3;;/h3H2,1-2H3;2*1H |
| CAS kay?t numaras? |
306-37-6 |
| EINECS |
206-183-5 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
166-167℃ |
| Kaynama noktas? |
63.9°C at 760 mmHg |
| Alevlenme noktas? |
1.1°C |
| Buhar bas?nc? |
168mmHg at 25°C |
| Tehlike Sembolleri |
T:Toxic;
|
| Risk Kodlar? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R45:May cause cancer.;
|
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|