3048-65-5 Tetrahydroindene
| ürün Ad? |
Tetrahydroindene |
| ingilizce ad? |
Tetrahydroindene; 3a,4,7,7a-Tetrahydroindene; 3a,4,7,7a-tetrahydro-1H-indene |
| Moleküler Formülü |
C9H12 |
| Molekül A??rl??? |
120.1916 |
| InChI |
InChI=1/C9H12/c1-2-5-9-7-3-6-8(9)4-1/h1-3,6,8-9H,4-5,7H2 |
| CAS kay?t numaras? |
3048-65-5 |
| EINECS |
221-260-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.944g/cm3 |
| Kaynama noktas? |
169.1°C at 760 mmHg |
| K?r?lma indisi |
1.521 |
| Alevlenme noktas? |
33.8°C |
| Buhar bas?nc? |
2.08mmHg at 25°C |
| Risk Kodlar? |
R10:Flammable.;
R65:Harmful: may cause lung damage if swallowed.;
|
| Güvenlik A??klamas? |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
S62:If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.;
|
|