3033-82-7 8-Chloroquinaldine
| ürün Ad? |
8-Chloroquinaldine |
| ingilizce ad? |
8-Chloroquinaldine; 8-Chloro-2-methylquinoline; 2-Methyl-8-chloroquinoline |
| Moleküler Formülü |
C10H8ClN |
| Molekül A??rl??? |
177.6302 |
| InChI |
InChI=1/C10H8ClN/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,1H3 |
| CAS kay?t numaras? |
3033-82-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.225g/cm3 |
| Ergime noktas? |
64-66℃ |
| Kaynama noktas? |
278.2°C at 760 mmHg |
| K?r?lma indisi |
1.634 |
| Alevlenme noktas? |
148.7°C |
| Buhar bas?nc? |
0.00732mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|