286-62-4 Cyclooctene oxide
| ürün Ad? |
Cyclooctene oxide |
| ingilizce ad? |
Cyclooctene oxide; 9-Oxabicyclo[6.1.0]nonane; Epoxycyclooctane~2-Oxabicyclo[6.1.0]nonane; Epoxycyclooctane; (1R,8S)-9-oxabicyclo[6.1.0]nonane; (1R,8R)-9-oxabicyclo[6.1.0]nonane; (1S,8S)-9-oxabicyclo[6.1.0]nonane |
| Moleküler Formülü |
C8H14O |
| Molekül A??rl??? |
126.1962 |
| InChI |
InChI=1/C8H14O/c1-2-4-6-8-7(9-8)5-3-1/h7-8H,1-6H2/t7-,8-/m0/s1 |
| CAS kay?t numaras? |
286-62-4 |
| EINECS |
206-010-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.958g/cm3 |
| Ergime noktas? |
53-56℃ |
| Kaynama noktas? |
189.3°C at 760 mmHg |
| K?r?lma indisi |
1.466 |
| Alevlenme noktas? |
56.1°C |
| Buhar bas?nc? |
0.793mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|