ChemNet > CAS > 2392-68-9 3-Chlorophenyl isothiocyanate
2392-68-9 3-Chlorophenyl isothiocyanate
| ürün Ad? |
3-Chlorophenyl isothiocyanate |
| ingilizce ad? |
3-Chlorophenyl isothiocyanate; 3-Chloroisothiocyanatobenzene; 1-chloro-3-isothiocyanatobenzene |
| Moleküler Formülü |
C7H4ClNS |
| Molekül A??rl??? |
169.6314 |
| InChI |
InChI=1/C7H4ClNS/c8-6-2-1-3-7(4-6)9-5-10/h1-4H |
| CAS kay?t numaras? |
2392-68-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.21g/cm3 |
| Kaynama noktas? |
249.5°C at 760 mmHg |
| K?r?lma indisi |
1.593 |
| Alevlenme noktas? |
117.4°C |
| Buhar bas?nc? |
0.0361mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|