ChemNet > CAS > 166330-10-5 Bis(2-diphenylphosphinophenyl)ether
166330-10-5 Bis(2-diphenylphosphinophenyl)ether
| ürün Ad? |
Bis(2-diphenylphosphinophenyl)ether |
| ingilizce ad? |
Bis(2-diphenylphosphinophenyl)ether; Bisdiphenylphosphinophenylether; (Oxydi-2,1-phenylene)-bis-(diphenylphosphine); (oxydi-2,1-phenylene)bis(diphenylphosphine); [2-(2-diphenylphosphanylphenoxy)phenyl]-diphenyl-phosphane; DPEPhos |
| Moleküler Formülü |
C36H28OP2 |
| Molekül A??rl??? |
538.5544 |
| InChI |
InChI=1/C36H28OP2/c1-5-17-29(18-6-1)38(30-19-7-2-8-20-30)35-27-15-13-25-33(35)37-34-26-14-16-28-36(34)39(31-21-9-3-10-22-31)32-23-11-4-12-24-32/h1-28H |
| CAS kay?t numaras? |
166330-10-5 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
184-187℃ |
| Kaynama noktas? |
608.19°C at 760 mmHg |
| Alevlenme noktas? |
404.905°C |
| Buhar bas?nc? |
0mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|