122-28-1 3-Nitroacetanilide
| ürün Ad? |
3-Nitroacetanilide |
| ingilizce ad? |
3-Nitroacetanilide;m-Nitroacetanilide; 3'-Nitroacetanilide; 3-Nitro-N-acetylaniline; AI3-08832; N-(3-Nitrophenyl)acetamide; N-Acetyl-m-nitroaniline; NSC 1314; Acetamide, N-(3-nitrophenyl)-; Acetanilide, 3'-nitro- (8CI) |
| Moleküler Formülü |
C8H8N2O3 |
| Molekül A??rl??? |
180.1607 |
| InChI |
InChI=1/C8H8N2O3/c1-6(11)9-7-3-2-4-8(5-7)10(12)13/h2-5H,1H3,(H,9,11) |
| CAS kay?t numaras? |
122-28-1 |
| EINECS |
204-532-6 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.34g/cm3 |
| Kaynama noktas? |
379°C at 760 mmHg |
| K?r?lma indisi |
1.617 |
| Alevlenme noktas? |
183°C |
| Buhar bas?nc? |
6.04E-06mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|