ChemNet > CAS > 120-53-6 6-ethoxy-2-mercaptobenzothiazole
120-53-6 6-ethoxy-2-mercaptobenzothiazole
| ürün Ad? |
6-ethoxy-2-mercaptobenzothiazole |
| ingilizce ad? |
6-ethoxy-2-mercaptobenzothiazole; 6-Ethoxybenzothiazolethiol; 6-ethoxy-1,3-benzothiazole-2(3H)-thione; 6-Ethoxy-Benzothiazole-2-Thiol |
| Moleküler Formülü |
C9H9NOS2 |
| Molekül A??rl??? |
211.3039 |
| InChI |
InChI=1/C9H9NOS2/c1-2-11-6-3-4-7-8(5-6)13-9(12)10-7/h3-5H,2H2,1H3,(H,10,12) |
| CAS kay?t numaras? |
120-53-6 |
| EINECS |
204-405-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.37g/cm3 |
| Ergime noktas? |
198-200℃ |
| Kaynama noktas? |
358.5°C at 760 mmHg |
| K?r?lma indisi |
1.698 |
| Alevlenme noktas? |
170.6°C |
| Buhar bas?nc? |
2.54E-05mmHg at 25°C |
| Risk Kodlar? |
R36/37:Irritating to eyes and respiratory system.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|