1122-60-7 ????????
| ???? |
???????? |
| ?? |
; ??????????? |
| ?? ?? |
nitrocyclohexane; Hexahydronitrobenzene |
| ??? |
C6H11NO2 |
| ??? |
129.157 |
| InChI |
InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| cas?? |
1122-60-7 |
| EC?? |
214-354-0 |
| ?? ?? |
|
| ?? |
1.05g/cm3 |
| ??? |
202.8°C at 760 mmHg |
| ?? ?? |
1.465 |
| ??? |
81.2°C |
| ??? |
0.287mmHg at 25°C |
| ??? ?? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| ?? ?? |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|