1119-46-6 5-Chlorovaleric acid
| ürün Ad? |
5-Chlorovaleric acid |
| ingilizce ad? |
5-Chlorovaleric acid; 214-279-3; pentanoic acid, 5-chloro-; 5-chloropentanoic acid |
| Moleküler Formülü |
C5H9ClO2 |
| Molekül A??rl??? |
136.5768 |
| InChI |
InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
| CAS kay?t numaras? |
1119-46-6 |
| EINECS |
214-279-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.166g/cm3 |
| Ergime noktas? |
18-20℃ |
| Kaynama noktas? |
230.9°C at 760 mmHg |
| K?r?lma indisi |
1.452 |
| Alevlenme noktas? |
93.4°C |
| Buhar bas?nc? |
0.0227mmHg at 25°C |
| Risk Kodlar? |
R34:Causes burns.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|