636-97-5 4-Nitrobenzhydrazide
| ??? ?????? |
4-Nitrobenzhydrazide |
| ????? ??????????? |
4-Nitrobenzhydrazide; 4-Nitrobenzoic hydrazide; 4-Nireobenzoylhydrazine; 4-Nitrobenzoic acid hydrazide; 4-Nitrobenzoyl hydrazide; 2,5-dihydro-3H-imidazo[1,2-b]pyrazole; 4-nitrobenzohydrazide |
| ?????? ???????? |
C7H7N3O3 |
| ????? ??????? ??????? |
181.1488 |
| InChI |
InChI=1/C7H7N3O3/c8-9-7(11)5-1-3-6(4-2-5)10(12)13/h1-4H,8H2,(H,9,11) |
| ?????????? ???????? ??????? |
636-97-5 |
| ???????? ????????? ??? |
211-271-1 |
| ???? ?????? |
|
| ????? |
1.406g/cm3 |
| ???? ???????? |
216-218℃ |
| ????? ???????? |
1.621 |
| ?????? ??? ??????? ?????? |
Xi:Irritant;
|
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|