615-74-7 2-Chloro-5-methylphenol
| ??? ?????? |
2-Chloro-5-methylphenol |
| ????? ??????????? |
2-Chloro-5-methylphenol; 4-Chloro-3-hydroxytoluene; 6-chloro-m-cresol |
| ?????? ???????? |
C7H7ClO |
| ????? ??????? ??????? |
142.58 |
| InChI |
InChI=1/C7H7ClO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
| ?????????? ???????? ??????? |
615-74-7 |
| ???????? ????????? ??? |
210-444-9 |
| ???? ?????? |
|
| ????? |
1.215 |
| ???? ???????? |
45-48℃ |
| ???? ??????? |
196℃ |
| ???? ?????? |
81℃ |
| ?????? ??? ??????? ?????? |
Xn:Harmful;
|
| ??? ????????? |
R21/22:Harmful in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|