552-32-9 2-Nitroacetanilide
| ??? ?????? |
2-Nitroacetanilide |
| ????? ??????????? |
2-Nitroacetanilide;o-Nitroacetanilide; 2'-Nitroacetanilide; AI3-08843; NSC 1313; Acetamide, N-(2-nitrophenyl)-; Acetanilide, 2'-nitro- (8CI); N-(2-nitrophenyl)acetamide |
| ?????? ???????? |
C8H8N2O3 |
| ????? ??????? ??????? |
180.1607 |
| InChI |
InChI=1/C8H8N2O3/c1-6(11)9-7-4-2-3-5-8(7)10(12)13/h2-5H,1H3,(H,9,11) |
| ?????????? ???????? ??????? |
552-32-9 |
| ???????? ????????? ??? |
209-009-6 |
| ???? ?????? |
|
| ????? |
1.34g/cm3 |
| ???? ???????? |
92-94℃ |
| ???? ??????? |
388.1°C at 760 mmHg |
| ????? ???????? |
1.617 |
| ???? ?????? |
188.5°C |
| ??? ?????? |
3.14E-06mmHg at 25°C |
| ?????? ??? ??????? ?????? |
Xi:Irritant;
|
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|