ChemNet > CAS > 4741-53-1 Tetraphenylphthalic anhydride
4741-53-1 Tetraphenylphthalic anhydride
| ??? ?????? |
Tetraphenylphthalic anhydride |
| ????? ??????????? |
Tetraphenylphthalic anhydride;4,5,6,7-tetraphenyl-2-benzofuran-1,3-dione |
| ?????? ???????? |
C32H20O3 |
| ????? ??????? ??????? |
452.4994 |
| InChI |
InChI=1/C32H20O3/c33-31-29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(30(29)32(34)35-31)24-19-11-4-12-20-24/h1-20H |
| ?????????? ???????? ??????? |
4741-53-1 |
| ???????? ????????? ??? |
225-253-6 |
| ???? ?????? |
|
| ????? |
1.244g/cm3 |
| ???? ??????? |
596°C at 760 mmHg |
| ????? ???????? |
1.658 |
| ???? ?????? |
290.4°C |
| ??? ?????? |
3.6E-14mmHg at 25°C |
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|