401-56-9 ethylchlorofluoroacetate
| ??? ?????? |
ethylchlorofluoroacetate |
| ????? ??????????? |
ethylchlorofluoroacetate; Ethyl chlorofluoroacetate; Chlorofluoroacetic acid ethyl ester; ethyl (2S)-chloro(fluoro)ethanoate; ethyl (2R)-chloro(fluoro)ethanoate |
| ?????? ???????? |
C4H6ClFO2 |
| ????? ??????? ??????? |
140.5406 |
| InChI |
InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
| ?????????? ???????? ??????? |
401-56-9 |
| ???????? ????????? ??? |
206-930-5 |
| ???? ?????? |
|
| ????? |
1.219g/cm3 |
| ???? ??????? |
129°C at 760 mmHg |
| ????? ???????? |
1.39 |
| ???? ?????? |
44.3°C |
| ??? ?????? |
10.4mmHg at 25°C |
| ?????? ??? ??????? ?????? |
C:Corrosive;
|
| ??? ????????? |
R34:Causes burns.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|