105-31-7 1-Hexyn-3-ol
| ??? ?????? |
1-Hexyn-3-ol |
| ????? ??????????? |
1-Hexyn-3-ol; Ethynyl n-propyl carbinol; hex-1-yn-3-ol; (3S)-hex-1-yn-3-ol; (3R)-hex-1-yn-3-ol |
| ?????? ???????? |
C6H10O |
| ????? ??????? ??????? |
98.143 |
| InChI |
InChI=1/C6H10O/c1-3-5-6(7)4-2/h2,6-7H,3,5H2,1H3/t6-/m0/s1 |
| ?????????? ???????? ??????? |
105-31-7 |
| ???????? ????????? ??? |
203-286-7 |
| ???? ?????? |
|
| ????? |
0.898g/cm3 |
| ???? ??????? |
140.3°C at 760 mmHg |
| ????? ???????? |
1.446 |
| ???? ?????? |
42.7°C |
| ??? ?????? |
2.54mmHg at 25°C |
| ??? ????????? |
R10:Flammable.;
R25:Toxic if swallowed.;
R27:Very toxic in contact with skin.;
|
| ???? ????? |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|