946-33-8 2-Benzylcyclohexanone
| Nome do produto |
2-Benzylcyclohexanone |
| Nome em inglês |
2-Benzylcyclohexanone;2-Benzylcyclohexan-1-one |
| Fórmula molecular |
C13H16O |
| Peso Molecular |
188.2655 |
| InChI |
InChI=1/C13H16O/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2 |
| CAS Registry Number |
946-33-8 |
| EINECS |
213-420-6 |
| Estrutura Molecular |
|
| Densidade |
1.038g/cm3 |
| Ponto de ebuli??o |
303.3°C at 760 mmHg |
| índice de refra??o |
1.541 |
| O ponto de inflama??o |
127.5°C |
| Press?o de vapor |
0.000939mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|