9003-53-6 Poly(styrene)
| Nome do produto |
Poly(styrene) |
| Nome em inglês |
Poly(styrene); Polystyrene; polystyrene standard 4000000; polystyrene standard 2000000; polystyrene standard 300000; polystyrene standard 1000000; polystyrene standard 700000; polystyrene standard 650000; polystyrene standard 2200000 certi-fied acc. to din; polystyrene standard 500000; polystyrene standard 8000000; Polystyrene (General Purpose Grade); Polystyrene, dicarboxy terminated; Polystyrene, methacrylate terminated solution; Styrene Resin (High M.Wt.); Styrene Latex; Styrene Resin (Low M.Wt.); Styrene Resin (Med.M.Wt.); Styrene-divinylbenzene copolymer (20% cross-linked); Polystyrene2% crosslinked with vinylbenzene; EPS; Expandable Polystyrene |
| Fórmula molecular |
C8H8 |
| Peso Molecular |
104.1491 |
| InChI |
InChI=1/C9H8/c1-8(2)9-6-4-3-5-7-9/h1-8H |
| CAS Registry Number |
9003-53-6 |
| Estrutura Molecular |
|
| Densidade |
1.047 |
| Ponto de ebuli??o |
212℃ |
| índice de refra??o |
1.5916 |
| solubilidade em água |
insoluble |
| Símbolos de perigo |
Xi:;
|
| Códigos de risco |
41:;
|
| Descri??o da Seguran?a |
S24/25:;
|
|