87-85-4 Hexamethylbenzene
| Nome do produto |
Hexamethylbenzene |
| Nome em inglês |
Hexamethylbenzene; Mellitene |
| Fórmula molecular |
C12H18 |
| Peso Molecular |
162.2713 |
| InChI |
InChI=1/C12H18/c1-7-8(2)10(4)12(6)11(5)9(7)3/h1-6H3 |
| CAS Registry Number |
87-85-4 |
| EINECS |
201-777-0 |
| Estrutura Molecular |
|
| Densidade |
0.867g/cm3 |
| Ponto de fus?o |
165-168℃ |
| Ponto de ebuli??o |
256.6°C at 760 mmHg |
| índice de refra??o |
1.501 |
| O ponto de inflama??o |
104.3°C |
| Press?o de vapor |
0.0245mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|