865-49-6 Chloroform-d
| Nome do produto |
Chloroform-d |
| Nome em inglês |
Chloroform-d; Chloroform-d+1% TMs (v/v); chloroform-D 99.8 atom % D*contains 1% tms; Chloroformdisotopicpuritytetramethylsilane; Chloroform-d + 0.05% TMS (v/v); Chloroformdiosotopicpurity; Chloroform D1; trichloro(~2~H)methane |
| Fórmula molecular |
CDCl3 |
| Peso Molecular |
120.3838 |
| InChI |
InChI=1/CHCl3/c2-1(3)4/h1H/i1D |
| CAS Registry Number |
865-49-6 |
| EINECS |
212-742-4 |
| Estrutura Molecular |
|
| Densidade |
1.512g/cm3 |
| Ponto de fus?o |
-64℃ |
| Ponto de ebuli??o |
61.2°C at 760 mmHg |
| índice de refra??o |
1.445 |
| Press?o de vapor |
200mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R22:Harmful if swallowed.;
R38:Irritating to skin.;
R40:Possible risks of irreversible effects.;
R48/20/22:Harmful : danger of serious damage to health by prolonged exposure through inhalation and if swallowed.;
|
| Descri??o da Seguran?a |
S36/37:Wear suitable protective clothing and gloves.;
|
|