82-58-6 D-Lysergic acid hydrate
| Nome do produto |
D-Lysergic acid hydrate |
| Nome em inglês |
D-Lysergic acid hydrate; 9,10-Didehydro-6-methylergoline-8-carboxylic acid; lysergic acid; (8beta)-6-methyl-9,10-didehydroergoline-8-carboxylic acid; 6-methyl-9,10-didehydroergoline-8-carboxylic acid; 9,10-Didehydro-6-Methyl-Ergoline-8-Carboxylic Acid |
| Fórmula molecular |
C16H16N2O2 |
| Peso Molecular |
268.3104 |
| InChI |
InChI=1/C16H16N2O2/c1-18-8-10(16(19)20)5-12-11-3-2-4-13-15(11)9(7-17-13)6-14(12)18/h2-5,7,10,14,17H,6,8H2,1H3,(H,19,20)/t10?,14-/m1/s1 |
| CAS Registry Number |
82-58-6 |
| EINECS |
201-431-9 |
| Estrutura Molecular |
|
| Densidade |
1.39g/cm3 |
| Ponto de fus?o |
220℃ |
| Ponto de ebuli??o |
536.2°C at 760 mmHg |
| índice de refra??o |
1.725 |
| O ponto de inflama??o |
278.1°C |
| Press?o de vapor |
2.51E-12mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R40:Possible risks of irreversible effects.;
|
| Descri??o da Seguran?a |
S13:Keep away from food, drink and animal feeding stuffs.;
S22:Do not inhale dust.;
S23:Do not inhale gas/fumes/vapour/spray.;
|
|