ChemNet > CAS > 646-01-5 3-(Methylthio)propionic acid
646-01-5 3-(Methylthio)propionic acid
| Nome do produto |
3-(Methylthio)propionic acid |
| Nome em inglês |
3-(Methylthio)propionic acid; 3-Methythiopropionic acid; 3-(methylsulfanyl)propanoate; 3-Methylthiopropionic Acid |
| Fórmula molecular |
C4H7O2S |
| Peso Molecular |
119.1627 |
| InChI |
InChI=1/C4H8O2S/c1-7-3-2-4(5)6/h2-3H2,1H3,(H,5,6)/p-1 |
| CAS Registry Number |
646-01-5 |
| EINECS |
211-460-9 |
| Estrutura Molecular |
|
| Ponto de ebuli??o |
249.2°C at 760 mmHg |
| O ponto de inflama??o |
104.5°C |
| Press?o de vapor |
0.00741mmHg at 25°C |
| Códigos de risco |
R34:Causes burns.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|