ChemNet > CAS > 620-88-2 4-Nitrophenyl phenyl ether
620-88-2 4-Nitrophenyl phenyl ether
| Nome do produto |
4-Nitrophenyl phenyl ether |
| Nome em inglês |
4-Nitrophenyl phenyl ether; p-Nitrodiphenyl ether; P-NITRODIPHENYLETHER; 1-nitro-4-phenoxybenzene; methyl 2-[(chloroacetyl)amino]benzoate; 2-chloro-N-(2-fluorophenyl)acetamide; 2-chloro-1-[2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrol-3-yl]ethanone |
| Fórmula molecular |
C15H16ClNO |
| Peso Molecular |
261.7466 |
| InChI |
InChI=1/C15H16ClNO/c1-10-4-6-13(7-5-10)17-11(2)8-14(12(17)3)15(18)9-16/h4-8H,9H2,1-3H3 |
| CAS Registry Number |
620-88-2 |
| EINECS |
210-656-1 |
| Estrutura Molecular |
|
| Densidade |
1.12g/cm3 |
| Ponto de fus?o |
53-56℃ |
| Ponto de ebuli??o |
399.6°C at 760 mmHg |
| índice de refra??o |
1.564 |
| O ponto de inflama??o |
195.4°C |
| Press?o de vapor |
1.36E-06mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|