618-32-6 Benzoyl bromide
| Nome do produto |
Benzoyl bromide |
| Nome em inglês |
Benzoyl bromide; |
| Fórmula molecular |
C7H5BrO |
| Peso Molecular |
185.018 |
| InChI |
InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| CAS Registry Number |
618-32-6 |
| EINECS |
210-544-2 |
| Estrutura Molecular |
|
| Densidade |
1.572g/cm3 |
| Ponto de fus?o |
-24℃ |
| Ponto de ebuli??o |
218.5°C at 760 mmHg |
| índice de refra??o |
1.584 |
| O ponto de inflama??o |
89.7°C |
| Press?o de vapor |
0.125mmHg at 25°C |
| Símbolos de perigo |
C:Corrosive;
|
| Códigos de risco |
R34:Causes burns.;
|
| Descri??o da Seguran?a |
S25:Avoid contact with eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|