613-62-7 BENZYL-2-NAPHTHYLETHER
| Nome do produto |
BENZYL-2-NAPHTHYLETHER |
| Nome em inglês |
BENZYL-2-NAPHTHYLETHER; BETA-NAPHTHYLBENZYLETHER (BON); 2-(phenylmethoxy)naphthalene; nbe; NIPAFAX BNE SENSLON-50; 2-(benzyloxy)naphthalene; 2-Benzyloxynaphthalene; 2-(Phenylmethoxy)-Naphthalene |
| Fórmula molecular |
C17H14O |
| Peso Molecular |
234.2925 |
| InChI |
InChI=1/C17H14O/c1-2-6-14(7-3-1)13-18-17-11-10-15-8-4-5-9-16(15)12-17/h1-12H,13H2 |
| CAS Registry Number |
613-62-7 |
| EINECS |
405-490-3 |
| Estrutura Molecular |
|
| Densidade |
1.125g/cm3 |
| Ponto de ebuli??o |
388.1°C at 760 mmHg |
| índice de refra??o |
1.642 |
| O ponto de inflama??o |
156.4°C |
| Press?o de vapor |
7.02E-06mmHg at 25°C |
| Códigos de risco |
R53:May cause long-term adverse effects in the aquatic environment.;
|
| Descri??o da Seguran?a |
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|