612-23-7 2-Nitrobenzyl chloride
| Nome do produto |
2-Nitrobenzyl chloride |
| Nome em inglês |
2-Nitrobenzyl chloride; alpha-Chloro-2-nitrotoluene; a-Chloro-2-nitrotoluene); 1-chloro-2-methyl-3-nitrobenzene; 1-(chloromethyl)-2-nitrobenzene |
| Fórmula molecular |
C7H6ClNO2 |
| Peso Molecular |
171.581 |
| InChI |
InChI=1/C7H6ClNO2/c8-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
| CAS Registry Number |
612-23-7 |
| EINECS |
210-300-5 |
| Estrutura Molecular |
|
| Densidade |
1.33g/cm3 |
| Ponto de fus?o |
46-50℃ |
| Ponto de ebuli??o |
269°C at 760 mmHg |
| índice de refra??o |
1.574 |
| O ponto de inflama??o |
112.7°C |
| Press?o de vapor |
0.0123mmHg at 25°C |
| Símbolos de perigo |
C:Corrosive;
|
| Códigos de risco |
R34:Causes burns.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|