603-52-1 ethyl diphenylcarbamate
| Nome do produto |
ethyl diphenylcarbamate |
| Nome em inglês |
ethyl diphenylcarbamate; |
| Fórmula molecular |
C15H15NO2 |
| Peso Molecular |
241.2851 |
| InChI |
InChI=1/C15H15NO2/c1-2-18-15(17)16(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| CAS Registry Number |
603-52-1 |
| EINECS |
210-047-0 |
| Estrutura Molecular |
|
| Densidade |
1.146g/cm3 |
| Ponto de fus?o |
70-72℃ |
| Ponto de ebuli??o |
360°C at 760 mmHg |
| índice de refra??o |
1.593 |
| O ponto de inflama??o |
171.5°C |
| Press?o de vapor |
2.29E-05mmHg at 25°C |
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|