602-55-1 9-Phenylanthracene
| Nome do produto |
9-Phenylanthracene |
| Nome em inglês |
9-Phenylanthracene; Phenylanthracene; anthracene,9-phenyl-; 9-phenylantracene |
| Fórmula molecular |
C20H14 |
| Peso Molecular |
254.3252 |
| InChI |
InChI=1/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H |
| CAS Registry Number |
602-55-1 |
| EINECS |
210-019-8 |
| Estrutura Molecular |
|
| Densidade |
1.14g/cm3 |
| Ponto de fus?o |
149-153℃ |
| Ponto de ebuli??o |
417°C at 760 mmHg |
| índice de refra??o |
1.703 |
| O ponto de inflama??o |
192.1°C |
| Press?o de vapor |
8.86E-07mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|