5328-01-8 1-Ethoxynaphthalene
| Nome do produto |
1-Ethoxynaphthalene |
| Nome em inglês |
1-Ethoxynaphthalene;Ethyl 1-naphthyl ether; Ethyl alpha-naphthyl ether; ; alpha-Ethoxynaphthalene; Naphthalene, 1-ethoxy-; 1-Naphthol ethyl ether; Naphtholethylether |
| Fórmula molecular |
C12H12O |
| Peso Molecular |
172.2231 |
| InChI |
InChI=1/C12H12O/c1-2-13-12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
| CAS Registry Number |
5328-01-8 |
| EINECS |
226-213-0 |
| Estrutura Molecular |
|
| Densidade |
1.049g/cm3 |
| Ponto de ebuli??o |
280.5°C at 760 mmHg |
| índice de refra??o |
1.59 |
| O ponto de inflama??o |
109.4°C |
| Press?o de vapor |
0.00641mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|