495-48-7 Azoxybenzene
| Nome do produto |
Azoxybenzene |
| Nome em inglês |
Azoxybenzene; Diphenyldiazene-1-oxide; Azoxylbenzene; [(Z)-phenyl-NNO-azoxy]benzene; [(E)-phenyl-NNO-azoxy]benzene |
| Fórmula molecular |
C12H10N2O |
| Peso Molecular |
198.22 |
| InChI |
InChI=1/C12H10N2O/c15-14(12-9-5-2-6-10-12)13-11-7-3-1-4-8-11/h1-10H |
| CAS Registry Number |
495-48-7 |
| EINECS |
207-802-1 |
| Estrutura Molecular |
|
| Ponto de fus?o |
32-36℃ |
| índice de refra??o |
1.582 |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R20/22:Harmful by inhalation and if swallowed.;
|
| Descri??o da Seguran?a |
S28A:After contact with skin, wash immediately with plenty of water.;
|
|