4861-85-2 Isopropyl Phenylacetate
| Nome do produto |
Isopropyl Phenylacetate |
| Nome em inglês |
Isopropyl Phenylacetate; 1-Methylethyl benzeneacetate; Acetic acid, phenyl-, isopropyl ester; Benzeneacetic acid, 1-methylethyl ester; FEMA No. 2956; Isopropyl alpha-toluate; propan-2-yl phenylacetate |
| Fórmula molecular |
C11H14O2 |
| Peso Molecular |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-9(2)13-11(12)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| CAS Registry Number |
4861-85-2 |
| EINECS |
225-468-5 |
| Estrutura Molecular |
|
| Densidade |
1.014g/cm3 |
| Ponto de ebuli??o |
237.7°C at 760 mmHg |
| índice de refra??o |
1.497 |
| O ponto de inflama??o |
97.5°C |
| Press?o de vapor |
0.0441mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|