484-17-3 9-Phenanthrol
| Nome do produto |
9-Phenanthrol |
| Nome em inglês |
9-Phenanthrol; 9-Hydroxyphenanthrene; phenanthren-9-ol |
| Fórmula molecular |
C14H10O |
| Peso Molecular |
194.2286 |
| InChI |
InChI=1/C14H10O/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,15H |
| CAS Registry Number |
484-17-3 |
| EINECS |
207-602-4 |
| Estrutura Molecular |
|
| Densidade |
1.244g/cm3 |
| Ponto de fus?o |
139-143℃ |
| Ponto de ebuli??o |
404.5°C at 760 mmHg |
| índice de refra??o |
1.753 |
| O ponto de inflama??o |
197.7°C |
| Press?o de vapor |
4.02E-07mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|