4685-47-6 3,4-Dimethylanisole
| Nome do produto |
3,4-Dimethylanisole |
| Nome em inglês |
3,4-Dimethylanisole; 1,2-Dimethyl-4-methoxybenzene; 4-Methoxy-o-xylene; 3-(methoxycarbonyl)-1-methylpyridinium; 4-methoxy-1,2-dimethyl-benzene |
| Fórmula molecular |
C9H12O |
| Peso Molecular |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-4-5-9(10-3)6-8(7)2/h4-6H,1-3H3 |
| CAS Registry Number |
4685-47-6 |
| EINECS |
225-142-2 |
| Estrutura Molecular |
|
| Densidade |
0.932g/cm3 |
| Ponto de ebuli??o |
203.1°C at 760 mmHg |
| índice de refra??o |
1.495 |
| O ponto de inflama??o |
75.6°C |
| Press?o de vapor |
0.402mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|