446-22-0 2'-fluoropropiophenone
| Nome do produto |
2'-fluoropropiophenone |
| Nome em inglês |
2'-fluoropropiophenone; 2'-fluoro-1-phenylpropan-1-one; 1-(2'-fluorophenyl)propan-1-one; 2-Fluoropropiophenone |
| Fórmula molecular |
C9H9FO |
| Peso Molecular |
152.1656 |
| InChI |
InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
| CAS Registry Number |
446-22-0 |
| EINECS |
244-220-7 |
| Estrutura Molecular |
|
| Densidade |
1.074g/cm3 |
| Ponto de ebuli??o |
204.119°C at 760 mmHg |
| índice de refra??o |
1.489 |
| O ponto de inflama??o |
77.067°C |
| Press?o de vapor |
0.268mmHg at 25°C |
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|