ChemNet > CAS > 4114-28-7 sym-Dicarbethoxyhydrazine
4114-28-7 sym-Dicarbethoxyhydrazine
| Nome do produto |
sym-Dicarbethoxyhydrazine |
| Nome em inglês |
sym-Dicarbethoxyhydrazine; Diethyl 1,2-hydrazinedicarboxylate; 1,2-dicarbethoxyhydrazine; diethyl bicarbamate; bis(ethoxycarbonyl)hydrazine; Diethyl hydrazodicarboxylate; N,N-Dicarboethoxyhydrazine; Diethyl hydrazodiformate; Hydrazine-N,N-dicarboxylic acid diethyl ester; 1,2-Hydrazinedicarboxylic acid diethyl ester; diethyl hydrazine-1,2-dicarboxylate |
| Fórmula molecular |
C6H12N2O4 |
| Peso Molecular |
176.1705 |
| InChI |
InChI=1/C6H12N2O4/c1-3-11-5(9)7-8-6(10)12-4-2/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
| CAS Registry Number |
4114-28-7 |
| EINECS |
223-902-8 |
| Estrutura Molecular |
|
| Densidade |
1.157g/cm3 |
| Ponto de fus?o |
130-135℃ |
| Ponto de ebuli??o |
250°C at 760 mmHg |
| índice de refra??o |
1.446 |
| O ponto de inflama??o |
105°C |
| Press?o de vapor |
0.0222mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|