38861-78-8 4-Isobutylacetophenone
| Nome do produto |
4-Isobutylacetophenone |
| Nome em inglês |
4-Isobutylacetophenone; 4-Isobutylacetaphenone; TIMTEC-BB SBB007668; P-ISO-BUTYLACETOPHENONE; IBUPROFEN IMPURITY E; IBUPROFEN IMP E; ISOBUTYL ACETOPHENONE; 4'-ISOBUTYLACETOPHENONE; 1-[4-(2-METHYLPROPYL)PHENYL]ETHANONE; 4-methyl-3-phenylpentan-2-one; 4'-(2-Methylpropyl)Acetophenone; 1Y1&1R DV1 |
| Fórmula molecular |
C12H16O |
| Peso Molecular |
176.2548 |
| InChI |
InChI=1/C12H16O/c1-9(2)12(10(3)13)11-7-5-4-6-8-11/h4-9,12H,1-3H3 |
| CAS Registry Number |
38861-78-8 |
| EINECS |
254-159-8 |
| Estrutura Molecular |
|
| Densidade |
0.944g/cm3 |
| Ponto de ebuli??o |
240.8°C at 760 mmHg |
| índice de refra??o |
1.494 |
| O ponto de inflama??o |
87°C |
| Press?o de vapor |
0.0372mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|