3377-87-5 3-bromohexane
| Nome do produto |
3-bromohexane |
| Nome em inglês |
3-bromohexane; Hexane, 3-bromo- |
| Fórmula molecular |
C6H13Br |
| Peso Molecular |
165.0714 |
| InChI |
InChI=1/C6H13Br/c1-3-5-6(7)4-2/h6H,3-5H2,1-2H3 |
| CAS Registry Number |
3377-87-5 |
| EINECS |
222-174-9 |
| Estrutura Molecular |
|
| Densidade |
1.169g/cm3 |
| Ponto de ebuli??o |
144°C at 760 mmHg |
| índice de refra??o |
1.444 |
| O ponto de inflama??o |
40.1°C |
| Press?o de vapor |
6.54mmHg at 25°C |
| Códigos de risco |
R10:Flammable.;
|
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|